C36H29ClN4O7 — CID 20722318
2-[2-(2-chloroanilino)-1-[3-[3-(2,4-dimethylphenoxy)propyl]-4-oxoquinazolin-2-yl]-2-oxoethyl]-1,3-dioxoisoindole-5-carboxylic acid (PubChem CID 20722318) has the molecular formula C36H29ClN4O7 and a molecular weight of 665.10 g/mol. Its IUPAC name is 2-[2-(2-chloroanilino)-1-[3-[3-(2,4-dimethylphenoxy)propyl]-4-oxoquinazolin-2-yl]-2-oxoethyl]-1,3-dioxoisoindole-5-carboxylic acid.
| Compound Name | 2-[2-(2-chloroanilino)-1-[3-[3-(2,4-dimethylphenoxy)propyl]-4-oxoquinazolin-2-yl]-2-oxoethyl]-1,3-dioxoisoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 20722318 |
| Molecular Formula | C36H29ClN4O7 |
| Molecular Weight | 665.10 g/mol |
| Exact Mass | 664.17 |
| IUPAC Name | 2-[2-(2-chloroanilino)-1-[3-[3-(2,4-dimethylphenoxy)propyl]-4-oxoquinazolin-2-yl]-2-oxoethyl]-1,3-dioxoisoindole-5-carboxylic acid |
| SMILES | Cc1ccc(OCCCn2c(C(C(=O)Nc3ccccc3Cl)N3C(=O)c4ccc(C(=O)O)cc4C3=O)nc3ccccc3c2=O)c(C)c1 |
| InChI | InChI=1S/C36H29ClN4O7/c1-20-12-15-29(21(2)18-20)48-17-7-16-40-31(38-27-10-5-3-8-24(27)33(40)43)30(32(42)39-28-11-6-4-9-26(28)37)41-34(44)23-14-13-22(36(46)47)19-25(23)35(41)45/h3-6,8-15,18-19,30H,7,16-17H2,1-2H3,(H,39,42)(H,46,47) |
| InChIKey | NBCKMBIZVVZMDI-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 147.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.10 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|