C18H25ClN2O5S — CID 58720639
ethyl 2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-chloroacetate (PubChem CID 58720639) has the molecular formula C18H25ClN2O5S and a molecular weight of 416.93 g/mol. Its IUPAC name is ethyl 2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-chloroacetate.
| Compound Name | ethyl 2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-chloroacetate |
|---|---|
| PubChem CID | 58720639 |
| Molecular Formula | C18H25ClN2O5S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | ethyl 2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]-2-chloroacetate |
| SMILES | CCCCOCCCN1C(C(Cl)C(=O)OCC)=Nc2ccccc2S1(=O)=O |
| InChI | InChI=1S/C18H25ClN2O5S/c1-3-5-12-25-13-8-11-21-17(16(19)18(22)26-4-2)20-14-9-6-7-10-15(14)27(21,23)24/h6-7,9-10,16H,3-5,8,11-13H2,1-2H3 |
| InChIKey | ATPBOWDZAGTBJG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|