C29H43N3O5S — CID 90952255
5-tert-butyl-2-methylaniline;ethyl 2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetate (PubChem CID 90952255) has the molecular formula C29H43N3O5S and a molecular weight of 545.75 g/mol. Its IUPAC name is 5-tert-butyl-2-methylaniline;ethyl 2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetate.
| Compound Name | 5-tert-butyl-2-methylaniline;ethyl 2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetate |
|---|---|
| PubChem CID | 90952255 |
| Molecular Formula | C29H43N3O5S |
| Molecular Weight | 545.75 g/mol |
| Exact Mass | 545.29 |
| IUPAC Name | 5-tert-butyl-2-methylaniline;ethyl 2-[2-(3-butoxypropyl)-1,1-dioxo-1λ6,2,4-benzothiadiazin-3-yl]acetate |
| SMILES | CCCCOCCCN1C(CC(=O)OCC)=Nc2ccccc2S1(=O)=O.Cc1ccc(C(C)(C)C)cc1N |
| InChI | InChI=1S/C18H26N2O5S.C11H17N/c1-3-5-12-24-13-8-11-20-17(14-18(21)25-4-2)19-15-9-6-7-10-16(15)26(20,22)23;1-8-5-6-9(7-10(8)12)11(2,3)4/h6-7,9-10H,3-5,8,11-14H2,1-2H3;5-7H,12H2,1-4H3 |
| InChIKey | NXAJJCGVKDAAOQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.75 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|