C19H29NO4 — CID 70835343
ethyl 2-(N-(3-butoxy-2,2-dimethylpropanoyl)anilino)acetate (PubChem CID 70835343) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is ethyl 2-(N-(3-butoxy-2,2-dimethylpropanoyl)anilino)acetate.
| Compound Name | ethyl 2-(N-(3-butoxy-2,2-dimethylpropanoyl)anilino)acetate |
|---|---|
| PubChem CID | 70835343 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | ethyl 2-(N-(3-butoxy-2,2-dimethylpropanoyl)anilino)acetate |
| SMILES | CCCCOCC(C)(C)C(=O)N(CC(=O)OCC)c1ccccc1 |
| InChI | InChI=1S/C19H29NO4/c1-5-7-13-23-15-19(3,4)18(22)20(14-17(21)24-6-2)16-11-9-8-10-12-16/h8-12H,5-7,13-15H2,1-4H3 |
| InChIKey | IFPXRGWYGNULER-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|