C23H27NO7 — CID 55306615
[2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 4-(4-methoxyphenoxy)butanoate (PubChem CID 55306615) has the molecular formula C23H27NO7 and a molecular weight of 429.47 g/mol. Its IUPAC name is [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 4-(4-methoxyphenoxy)butanoate.
| Compound Name | [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 4-(4-methoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 55306615 |
| Molecular Formula | C23H27NO7 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 4-(4-methoxyphenoxy)butanoate |
| SMILES | CCOC(=O)CN(C(=O)COC(=O)CCCOc1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C23H27NO7/c1-3-29-23(27)16-24(18-8-5-4-6-9-18)21(25)17-31-22(26)10-7-15-30-20-13-11-19(28-2)12-14-20/h4-6,8-9,11-14H,3,7,10,15-17H2,1-2H3 |
| InChIKey | JCTROEZTPUGHPQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|