C22H24N2O7 — CID 42976059
[2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 2-[(2-phenoxyacetyl)amino]acetate (PubChem CID 42976059) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 2-[(2-phenoxyacetyl)amino]acetate.
| Compound Name | [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 2-[(2-phenoxyacetyl)amino]acetate |
|---|---|
| PubChem CID | 42976059 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [2-(N-(2-ethoxy-2-oxoethyl)anilino)-2-oxoethyl] 2-[(2-phenoxyacetyl)amino]acetate |
| SMILES | CCOC(=O)CN(C(=O)COC(=O)CNC(=O)COc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O7/c1-2-29-22(28)14-24(17-9-5-3-6-10-17)20(26)16-31-21(27)13-23-19(25)15-30-18-11-7-4-8-12-18/h3-12H,2,13-16H2,1H3,(H,23,25) |
| InChIKey | XTKDTWAECYZSQH-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |