C23H27F3O4 — CID 142158583
7-[3-[2-propyl-4-(2,2,2-trifluoroethoxy)phenoxy]propoxy]-3,4-dihydro-2H-chromene (PubChem CID 142158583) has the molecular formula C23H27F3O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 7-[3-[2-propyl-4-(2,2,2-trifluoroethoxy)phenoxy]propoxy]-3,4-dihydro-2H-chromene.
| Compound Name | 7-[3-[2-propyl-4-(2,2,2-trifluoroethoxy)phenoxy]propoxy]-3,4-dihydro-2H-chromene |
|---|---|
| PubChem CID | 142158583 |
| Molecular Formula | C23H27F3O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 7-[3-[2-propyl-4-(2,2,2-trifluoroethoxy)phenoxy]propoxy]-3,4-dihydro-2H-chromene |
| SMILES | CCCc1cc(OCC(F)(F)F)ccc1OCCCOc1ccc2c(c1)OCCC2 |
| InChI | InChI=1S/C23H27F3O4/c1-2-5-18-14-19(30-16-23(24,25)26)9-10-21(18)28-13-4-12-27-20-8-7-17-6-3-11-29-22(17)15-20/h7-10,14-15H,2-6,11-13,16H2,1H3 |
| InChIKey | VNLRGFHFSQPWMM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|