C22H22ClF3O4 — CID 142158555
7-[4-[2-chloro-4-(2,2,2-trifluoroethoxy)phenyl]butoxy]-3,4-dihydro-2H-chromene-2-carbaldehyde (PubChem CID 142158555) has the molecular formula C22H22ClF3O4 and a molecular weight of 442.86 g/mol. Its IUPAC name is 7-[4-[2-chloro-4-(2,2,2-trifluoroethoxy)phenyl]butoxy]-3,4-dihydro-2H-chromene-2-carbaldehyde.
| Compound Name | 7-[4-[2-chloro-4-(2,2,2-trifluoroethoxy)phenyl]butoxy]-3,4-dihydro-2H-chromene-2-carbaldehyde |
|---|---|
| PubChem CID | 142158555 |
| Molecular Formula | C22H22ClF3O4 |
| Molecular Weight | 442.86 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 7-[4-[2-chloro-4-(2,2,2-trifluoroethoxy)phenyl]butoxy]-3,4-dihydro-2H-chromene-2-carbaldehyde |
| SMILES | O=CC1CCc2ccc(OCCCCc3ccc(OCC(F)(F)F)cc3Cl)cc2O1 |
| InChI | InChI=1S/C22H22ClF3O4/c23-20-11-17(29-14-22(24,25)26)7-4-15(20)3-1-2-10-28-18-8-5-16-6-9-19(13-27)30-21(16)12-18/h4-5,7-8,11-13,19H,1-3,6,9-10,14H2 |
| InChIKey | DMYPMJZRNYRKEA-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.86 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|