C14H11ClF6O2 — CID 162383833
2-[2-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-2-[1-(trifluoromethyl)cyclopropyl]oxirane (PubChem CID 162383833) has the molecular formula C14H11ClF6O2 and a molecular weight of 360.68 g/mol. Its IUPAC name is 2-[2-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-2-[1-(trifluoromethyl)cyclopropyl]oxirane.
| Compound Name | 2-[2-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-2-[1-(trifluoromethyl)cyclopropyl]oxirane |
|---|---|
| PubChem CID | 162383833 |
| Molecular Formula | C14H11ClF6O2 |
| Molecular Weight | 360.68 g/mol |
| Exact Mass | 360.04 |
| IUPAC Name | 2-[2-chloro-4-(2,2,2-trifluoroethoxy)phenyl]-2-[1-(trifluoromethyl)cyclopropyl]oxirane |
| SMILES | FC(F)(F)COc1ccc(C2(C3(C(F)(F)F)CC3)CO2)c(Cl)c1 |
| InChI | InChI=1S/C14H11ClF6O2/c15-10-5-8(22-7-13(16,17)18)1-2-9(10)12(6-23-12)11(3-4-11)14(19,20)21/h1-2,5H,3-4,6-7H2 |
| InChIKey | UXOWSTIPDSGNDS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.68 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|