C22H24ClF3O4 — CID 142158551
7-[3-[2-chloro-4-(trifluoromethyl)phenoxy]propoxy]-3,4-dihydro-2H-chromene-2-carbaldehyde;ethane (PubChem CID 142158551) has the molecular formula C22H24ClF3O4 and a molecular weight of 444.88 g/mol. Its IUPAC name is 7-[3-[2-chloro-4-(trifluoromethyl)phenoxy]propoxy]-3,4-dihydro-2H-chromene-2-carbaldehyde;ethane.
| Compound Name | 7-[3-[2-chloro-4-(trifluoromethyl)phenoxy]propoxy]-3,4-dihydro-2H-chromene-2-carbaldehyde;ethane |
|---|---|
| PubChem CID | 142158551 |
| Molecular Formula | C22H24ClF3O4 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 7-[3-[2-chloro-4-(trifluoromethyl)phenoxy]propoxy]-3,4-dihydro-2H-chromene-2-carbaldehyde;ethane |
| SMILES | CC.O=CC1CCc2ccc(OCCCOc3ccc(C(F)(F)F)cc3Cl)cc2O1 |
| InChI | InChI=1S/C20H18ClF3O4.C2H6/c21-17-10-14(20(22,23)24)4-7-18(17)27-9-1-8-26-15-5-2-13-3-6-16(12-25)28-19(13)11-15;1-2/h2,4-5,7,10-12,16H,1,3,6,8-9H2;1-2H3 |
| InChIKey | RXLZEQMMVZCARD-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|