C24H29ClO6 — CID 21303593
7-[3-(2-chloro-4-ethoxyphenoxy)propoxy]-2-propyl-3,4-dihydrochromene-2-carboxylic acid (PubChem CID 21303593) has the molecular formula C24H29ClO6 and a molecular weight of 448.94 g/mol. Its IUPAC name is 7-[3-(2-chloro-4-ethoxyphenoxy)propoxy]-2-propyl-3,4-dihydrochromene-2-carboxylic acid.
| Compound Name | 7-[3-(2-chloro-4-ethoxyphenoxy)propoxy]-2-propyl-3,4-dihydrochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 21303593 |
| Molecular Formula | C24H29ClO6 |
| Molecular Weight | 448.94 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 7-[3-(2-chloro-4-ethoxyphenoxy)propoxy]-2-propyl-3,4-dihydrochromene-2-carboxylic acid |
| SMILES | CCCC1(C(=O)O)CCc2ccc(OCCCOc3ccc(OCC)cc3Cl)cc2O1 |
| InChI | InChI=1S/C24H29ClO6/c1-3-11-24(23(26)27)12-10-17-6-7-19(16-22(17)31-24)29-13-5-14-30-21-9-8-18(28-4-2)15-20(21)25/h6-9,15-16H,3-5,10-14H2,1-2H3,(H,26,27) |
| InChIKey | OQJDHQBJYHPRPO-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.94 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|