C29H37F3O2 — CID 142158569
2-ethenyl-2-ethyl-7-[4-[2-propyl-4-(3,3,3-trifluoropropyl)phenyl]butoxy]-3,4-dihydrochromene (PubChem CID 142158569) has the molecular formula C29H37F3O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is 2-ethenyl-2-ethyl-7-[4-[2-propyl-4-(3,3,3-trifluoropropyl)phenyl]butoxy]-3,4-dihydrochromene.
| Compound Name | 2-ethenyl-2-ethyl-7-[4-[2-propyl-4-(3,3,3-trifluoropropyl)phenyl]butoxy]-3,4-dihydrochromene |
|---|---|
| PubChem CID | 142158569 |
| Molecular Formula | C29H37F3O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | 2-ethenyl-2-ethyl-7-[4-[2-propyl-4-(3,3,3-trifluoropropyl)phenyl]butoxy]-3,4-dihydrochromene |
| SMILES | C=CC1(CC)CCc2ccc(OCCCCc3ccc(CCC(F)(F)F)cc3CCC)cc2O1 |
| InChI | InChI=1S/C29H37F3O2/c1-4-9-25-20-22(15-18-29(30,31)32)11-12-23(25)10-7-8-19-33-26-14-13-24-16-17-28(5-2,6-3)34-27(24)21-26/h5,11-14,20-21H,2,4,6-10,15-19H2,1,3H3 |
| InChIKey | NBCAMAMOYXOISP-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|