About 3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide
3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide (PubChem CID 141195353) has the molecular formula C16H23NO3
and a molecular weight of 277.36 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide |
| PubChem CID | 141195353 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCOc1ccc2c(c1)OCCC2 |
| InChI | InChI=1S/C16H23NO3/c1-3-17(4-2)16(18)9-11-19-14-8-7-13-6-5-10-20-15(13)12-14/h7-8,12H,3-6,9-11H2,1-2H3 |
| InChIKey | HXNBQEGPWSGBSC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide?
The IUPAC name of 3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide (CID 141195353) is 3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide.
What is the SMILES notation for 3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide?
The canonical SMILES for 3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide is CCN(CC)C(=O)CCOc1ccc2c(c1)OCCC2.
What is the InChIKey of 3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide?
The InChIKey is HXNBQEGPWSGBSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO3/c1-3-17(4-2)16(18)9-11-19-14-8-7-13-6-5-10-20-15(13)12-14/h7-8,12H,3-6,9-11H2,1-2H3.
What are the key properties of 3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide?
3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide has a molecular weight of 277.36 g/mol, XLogP of 2.65, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-diethylpropanamide is sourced from PubChem (CID 141195353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).