C15H21NO3 — CID 141195387
4-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-dimethylbutanamide (PubChem CID 141195387) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-dimethylbutanamide.
| Compound Name | 4-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 141195387 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 4-(3,4-dihydro-2H-chromen-7-yloxy)-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCOc1ccc2c(c1)OCCC2 |
| InChI | InChI=1S/C15H21NO3/c1-16(2)15(17)6-4-9-18-13-8-7-12-5-3-10-19-14(12)11-13/h7-8,11H,3-6,9-10H2,1-2H3 |
| InChIKey | BNSWHCYLZWXAJI-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|