C16H14O7 — CID 141414839
4-(3,4-dihydro-2H-chromen-7-ylperoxyperoxy)benzoic acid (PubChem CID 141414839) has the molecular formula C16H14O7 and a molecular weight of 318.28 g/mol. Its IUPAC name is 4-(3,4-dihydro-2H-chromen-7-ylperoxyperoxy)benzoic acid.
| Compound Name | 4-(3,4-dihydro-2H-chromen-7-ylperoxyperoxy)benzoic acid |
|---|---|
| PubChem CID | 141414839 |
| Molecular Formula | C16H14O7 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 4-(3,4-dihydro-2H-chromen-7-ylperoxyperoxy)benzoic acid |
| SMILES | O=C(O)c1ccc(OOOOc2ccc3c(c2)OCCC3)cc1 |
| InChI | InChI=1S/C16H14O7/c17-16(18)12-4-6-13(7-5-12)20-22-23-21-14-8-3-11-2-1-9-19-15(11)10-14/h3-8,10H,1-2,9H2,(H,17,18) |
| InChIKey | BVRNOXMRFWREGF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|