C28H31ClO5 — CID 22761096
2-(4-tert-butylphenoxy)-2-[4-[3-(4-chlorophenoxy)propoxy]phenyl]propanoic acid (PubChem CID 22761096) has the molecular formula C28H31ClO5 and a molecular weight of 483.00 g/mol. Its IUPAC name is 2-(4-tert-butylphenoxy)-2-[4-[3-(4-chlorophenoxy)propoxy]phenyl]propanoic acid.
| Compound Name | 2-(4-tert-butylphenoxy)-2-[4-[3-(4-chlorophenoxy)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22761096 |
| Molecular Formula | C28H31ClO5 |
| Molecular Weight | 483.00 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | 2-(4-tert-butylphenoxy)-2-[4-[3-(4-chlorophenoxy)propoxy]phenyl]propanoic acid |
| SMILES | CC(C)(C)c1ccc(OC(C)(C(=O)O)c2ccc(OCCCOc3ccc(Cl)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H31ClO5/c1-27(2,3)20-6-14-25(15-7-20)34-28(4,26(30)31)21-8-12-23(13-9-21)32-18-5-19-33-24-16-10-22(29)11-17-24/h6-17H,5,18-19H2,1-4H3,(H,30,31) |
| InChIKey | VWEKOGKOCPAFPL-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.00 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|