C27H30ClF3O6 — CID 150349365
methyl 2-[4-[3-[6-chloro-2,2-dimethyl-4-(trifluoromethyl)chromen-3-yl]oxypropoxy]phenoxy]-2-methylbutanoate (PubChem CID 150349365) has the molecular formula C27H30ClF3O6 and a molecular weight of 542.98 g/mol. Its IUPAC name is methyl 2-[4-[3-[6-chloro-2,2-dimethyl-4-(trifluoromethyl)chromen-3-yl]oxypropoxy]phenoxy]-2-methylbutanoate.
| Compound Name | methyl 2-[4-[3-[6-chloro-2,2-dimethyl-4-(trifluoromethyl)chromen-3-yl]oxypropoxy]phenoxy]-2-methylbutanoate |
|---|---|
| PubChem CID | 150349365 |
| Molecular Formula | C27H30ClF3O6 |
| Molecular Weight | 542.98 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | methyl 2-[4-[3-[6-chloro-2,2-dimethyl-4-(trifluoromethyl)chromen-3-yl]oxypropoxy]phenoxy]-2-methylbutanoate |
| SMILES | CCC(C)(Oc1ccc(OCCCOC2=C(C(F)(F)F)c3cc(Cl)ccc3OC2(C)C)cc1)C(=O)OC |
| InChI | InChI=1S/C27H30ClF3O6/c1-6-26(4,24(32)33-5)36-19-11-9-18(10-12-19)34-14-7-15-35-23-22(27(29,30)31)20-16-17(28)8-13-21(20)37-25(23,2)3/h8-13,16H,6-7,14-15H2,1-5H3 |
| InChIKey | GTKFDORUKWTBFR-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.98 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|