C25H27FO4 — CID 91589353
ethyl 3-(7-ethoxy-2,2-dimethyl-4-phenylchromen-6-yl)-2-fluorobut-2-enoate (PubChem CID 91589353) has the molecular formula C25H27FO4 and a molecular weight of 410.49 g/mol. Its IUPAC name is ethyl 3-(7-ethoxy-2,2-dimethyl-4-phenylchromen-6-yl)-2-fluorobut-2-enoate.
| Compound Name | ethyl 3-(7-ethoxy-2,2-dimethyl-4-phenylchromen-6-yl)-2-fluorobut-2-enoate |
|---|---|
| PubChem CID | 91589353 |
| Molecular Formula | C25H27FO4 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | ethyl 3-(7-ethoxy-2,2-dimethyl-4-phenylchromen-6-yl)-2-fluorobut-2-enoate |
| SMILES | CCOC(=O)C(F)=C(C)c1cc2c(cc1OCC)OC(C)(C)C=C2c1ccccc1 |
| InChI | InChI=1S/C25H27FO4/c1-6-28-21-14-22-19(13-18(21)16(3)23(26)24(27)29-7-2)20(15-25(4,5)30-22)17-11-9-8-10-12-17/h8-15H,6-7H2,1-5H3 |
| InChIKey | NRGDQFMVXFSVHF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|