C25H36O3 — CID 10872705
ethyl (2E,4E,6Z)-7-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-3-methylocta-2,4,6-trienoate (PubChem CID 10872705) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is ethyl (2E,4E,6Z)-7-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-3-methylocta-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6Z)-7-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-3-methylocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 10872705 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | ethyl (2E,4E,6Z)-7-[2-ethoxy-3,5-di(propan-2-yl)phenyl]-3-methylocta-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C=C(/C)c1cc(C(C)C)cc(C(C)C)c1OCC |
| InChI | InChI=1S/C25H36O3/c1-9-27-24(26)14-19(7)12-11-13-20(8)23-16-21(17(3)4)15-22(18(5)6)25(23)28-10-2/h11-18H,9-10H2,1-8H3/b12-11+,19-14+,20-13- |
| InChIKey | AOFYKBPBQVJOBJ-YPILQDMCSA-N |
| XLogP | 6.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|