C27H40O2 — CID 142245881
(2E,4E,6Z)-7-[2-hexoxy-3,5-di(propan-2-yl)phenyl]-3-methylocta-2,4,6-trienal (PubChem CID 142245881) has the molecular formula C27H40O2 and a molecular weight of 396.62 g/mol. Its IUPAC name is (2E,4E,6Z)-7-[2-hexoxy-3,5-di(propan-2-yl)phenyl]-3-methylocta-2,4,6-trienal.
| Compound Name | (2E,4E,6Z)-7-[2-hexoxy-3,5-di(propan-2-yl)phenyl]-3-methylocta-2,4,6-trienal |
|---|---|
| PubChem CID | 142245881 |
| Molecular Formula | C27H40O2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | (2E,4E,6Z)-7-[2-hexoxy-3,5-di(propan-2-yl)phenyl]-3-methylocta-2,4,6-trienal |
| SMILES | CCCCCCOc1c(/C(C)=C\C=C\C(C)=C\C=O)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C27H40O2/c1-8-9-10-11-17-29-27-25(21(4)5)18-24(20(2)3)19-26(27)23(7)14-12-13-22(6)15-16-28/h12-16,18-21H,8-11,17H2,1-7H3/b13-12+,22-15+,23-14- |
| InChIKey | HPPNYZYTTQMYIE-SFWKXRGPSA-N |
| XLogP | 8.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|