C30H44O2 — CID 54343743
butyl 3,7-dimethyl-9-[2,4,6-tri(propan-2-yl)phenyl]nona-2,4,6,8-tetraenoate (PubChem CID 54343743) has the molecular formula C30H44O2 and a molecular weight of 436.68 g/mol. Its IUPAC name is butyl 3,7-dimethyl-9-[2,4,6-tri(propan-2-yl)phenyl]nona-2,4,6,8-tetraenoate.
| Compound Name | butyl 3,7-dimethyl-9-[2,4,6-tri(propan-2-yl)phenyl]nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 54343743 |
| Molecular Formula | C30H44O2 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.33 |
| IUPAC Name | butyl 3,7-dimethyl-9-[2,4,6-tri(propan-2-yl)phenyl]nona-2,4,6,8-tetraenoate |
| SMILES | CCCCOC(=O)C=C(C)C=CC=C(C)C=Cc1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C30H44O2/c1-10-11-17-32-30(31)18-25(9)14-12-13-24(8)15-16-27-28(22(4)5)19-26(21(2)3)20-29(27)23(6)7/h12-16,18-23H,10-11,17H2,1-9H3 |
| InChIKey | UAURAOBLXNZSKT-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|