C28H40O4 — CID 14676428
ethyl (2E,4E,6E,8E)-9-(5-hydroxy-2-nonoxyphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate (PubChem CID 14676428) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E)-9-(5-hydroxy-2-nonoxyphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate.
| Compound Name | ethyl (2E,4E,6E,8E)-9-(5-hydroxy-2-nonoxyphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 14676428 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | ethyl (2E,4E,6E,8E)-9-(5-hydroxy-2-nonoxyphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
| SMILES | CCCCCCCCCOc1ccc(O)cc1/C=C/C(C)=C/C=C/C(C)=C/C(=O)OCC |
| InChI | InChI=1S/C28H40O4/c1-5-7-8-9-10-11-12-20-32-27-19-18-26(29)22-25(27)17-16-23(3)14-13-15-24(4)21-28(30)31-6-2/h13-19,21-22,29H,5-12,20H2,1-4H3/b15-13+,17-16+,23-14+,24-21+ |
| InChIKey | PKIMFAFLXXFAQB-SFVQUHHUSA-N |
| XLogP | 7.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|