C29H39F3O3 — CID 54300661
ethyl 3,7-dimethyl-9-[2-nonoxy-6-(trifluoromethyl)phenyl]nona-2,4,6,8-tetraenoate (PubChem CID 54300661) has the molecular formula C29H39F3O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is ethyl 3,7-dimethyl-9-[2-nonoxy-6-(trifluoromethyl)phenyl]nona-2,4,6,8-tetraenoate.
| Compound Name | ethyl 3,7-dimethyl-9-[2-nonoxy-6-(trifluoromethyl)phenyl]nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 54300661 |
| Molecular Formula | C29H39F3O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | ethyl 3,7-dimethyl-9-[2-nonoxy-6-(trifluoromethyl)phenyl]nona-2,4,6,8-tetraenoate |
| SMILES | CCCCCCCCCOc1cccc(C(F)(F)F)c1C=CC(C)=CC=CC(C)=CC(=O)OCC |
| InChI | InChI=1S/C29H39F3O3/c1-5-7-8-9-10-11-12-21-35-27-18-14-17-26(29(30,31)32)25(27)20-19-23(3)15-13-16-24(4)22-28(33)34-6-2/h13-20,22H,5-12,21H2,1-4H3 |
| InChIKey | SDYFIPCINABCIC-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|