C18H22O2S — CID 12875239
ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(5-methylthiophen-2-yl)nona-2,4,6,8-tetraenoate (PubChem CID 12875239) has the molecular formula C18H22O2S and a molecular weight of 302.44 g/mol. Its IUPAC name is ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(5-methylthiophen-2-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(5-methylthiophen-2-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 12875239 |
| Molecular Formula | C18H22O2S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(5-methylthiophen-2-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C=C(C)/C=C/c1ccc(C)s1 |
| InChI | InChI=1S/C18H22O2S/c1-5-20-18(19)13-15(3)8-6-7-14(2)9-11-17-12-10-16(4)21-17/h6-13H,5H2,1-4H3/b8-6+,11-9+,14-7+,15-13+ |
| InChIKey | HFGOCANPUWDPFK-BJFGXJFTSA-N |
| XLogP | 5.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|