C17H17Br3O2S — CID 173437973
ethyl (8Z)-3,7-dimethyl-9-(3,4,5-tribromothiophen-2-yl)nona-2,4,6,8-tetraenoate (PubChem CID 173437973) has the molecular formula C17H17Br3O2S and a molecular weight of 525.10 g/mol. Its IUPAC name is ethyl (8Z)-3,7-dimethyl-9-(3,4,5-tribromothiophen-2-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | ethyl (8Z)-3,7-dimethyl-9-(3,4,5-tribromothiophen-2-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 173437973 |
| Molecular Formula | C17H17Br3O2S |
| Molecular Weight | 525.10 g/mol |
| Exact Mass | 521.85 |
| IUPAC Name | ethyl (8Z)-3,7-dimethyl-9-(3,4,5-tribromothiophen-2-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CCOC(=O)C=C(C)C=CC=C(C)/C=C\c1sc(Br)c(Br)c1Br |
| InChI | InChI=1S/C17H17Br3O2S/c1-4-22-14(21)10-12(3)7-5-6-11(2)8-9-13-15(18)16(19)17(20)23-13/h5-10H,4H2,1-3H3/b7-5?,9-8-,11-6?,12-10? |
| InChIKey | UVWWTADEVQOCLI-GYRDWEQASA-N |
| XLogP | 7.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.10 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|