C20H26O2S — CID 131710955
ethyl (4E)-3,7-dimethyl-9-(3,4,5-trimethylthiophen-2-yl)nona-2,4,6,8-tetraenoate (PubChem CID 131710955) has the molecular formula C20H26O2S and a molecular weight of 330.49 g/mol. Its IUPAC name is ethyl (4E)-3,7-dimethyl-9-(3,4,5-trimethylthiophen-2-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | ethyl (4E)-3,7-dimethyl-9-(3,4,5-trimethylthiophen-2-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 131710955 |
| Molecular Formula | C20H26O2S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | ethyl (4E)-3,7-dimethyl-9-(3,4,5-trimethylthiophen-2-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CCOC(=O)C=C(C)/C=C/C=C(C)C=Cc1sc(C)c(C)c1C |
| InChI | InChI=1S/C20H26O2S/c1-7-22-20(21)13-15(3)10-8-9-14(2)11-12-19-17(5)16(4)18(6)23-19/h8-13H,7H2,1-6H3/b10-8+,12-11?,14-9?,15-13? |
| InChIKey | CJIGKFRYLBZUPU-ZNZUKJCWSA-N |
| XLogP | 5.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|