C19H29NO — CID 170798906
4-[2,4,6-tri(propan-2-yl)phenyl]but-3-enamide (PubChem CID 170798906) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 4-[2,4,6-tri(propan-2-yl)phenyl]but-3-enamide.
| Compound Name | 4-[2,4,6-tri(propan-2-yl)phenyl]but-3-enamide |
|---|---|
| PubChem CID | 170798906 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 4-[2,4,6-tri(propan-2-yl)phenyl]but-3-enamide |
| SMILES | CC(C)c1cc(C(C)C)c(C=CCC(N)=O)c(C(C)C)c1 |
| InChI | InChI=1S/C19H29NO/c1-12(2)15-10-17(13(3)4)16(8-7-9-19(20)21)18(11-15)14(5)6/h7-8,10-14H,9H2,1-6H3,(H2,20,21) |
| InChIKey | SUTAPJVPQKEDTC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |