About 1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene
1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene (PubChem CID 159400113) has the molecular formula C19H30
and a molecular weight of 258.45 g/mol. Its IUPAC name is 1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene.
Molecular Properties
| Compound Name | 1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene |
| PubChem CID | 159400113 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene |
| SMILES | Cc1cc(C(C)C)cc(C(C)C)c1/C=C\CC(C)C |
| InChI | InChI=1S/C19H30/c1-13(2)9-8-10-18-16(7)11-17(14(3)4)12-19(18)15(5)6/h8,10-15H,9H2,1-7H3/b10-8- |
| InChIKey | MBSCJVYDLRIHLU-NTMALXAHSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene?
The IUPAC name of 1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene (CID 159400113) is 1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene.
What is the SMILES notation for 1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene?
The canonical SMILES for 1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene is Cc1cc(C(C)C)cc(C(C)C)c1/C=C\CC(C)C.
What is the InChIKey of 1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene?
The InChIKey is MBSCJVYDLRIHLU-NTMALXAHSA-N. The full InChI is InChI=1S/C19H30/c1-13(2)9-8-10-18-16(7)11-17(14(3)4)12-19(18)15(5)6/h8,10-15H,9H2,1-7H3/b10-8-.
What are the key properties of 1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene?
1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene has a molecular weight of 258.45 g/mol, XLogP of 6.30, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-[(Z)-4-methylpent-1-enyl]-3,5-di(propan-2-yl)benzene is sourced from PubChem (CID 159400113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).