C14H20IN — CID 137446405
N-iodo-N,3-dimethyl-5-propan-2-yl-4-[(Z)-prop-1-enyl]aniline (PubChem CID 137446405) has the molecular formula C14H20IN and a molecular weight of 329.23 g/mol. Its IUPAC name is N-iodo-N,3-dimethyl-5-propan-2-yl-4-[(Z)-prop-1-enyl]aniline.
| Compound Name | N-iodo-N,3-dimethyl-5-propan-2-yl-4-[(Z)-prop-1-enyl]aniline |
|---|---|
| PubChem CID | 137446405 |
| Molecular Formula | C14H20IN |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | N-iodo-N,3-dimethyl-5-propan-2-yl-4-[(Z)-prop-1-enyl]aniline |
| SMILES | C/C=C\c1c(C)cc(N(C)I)cc1C(C)C |
| InChI | InChI=1S/C14H20IN/c1-6-7-13-11(4)8-12(16(5)15)9-14(13)10(2)3/h6-10H,1-5H3/b7-6- |
| InChIKey | ROSBQGRKZBWDEQ-SREVYHEPSA-N |
| XLogP | 4.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|