C13H17NO — CID 170797721
4-(2,4,6-trimethylphenyl)but-3-enamide (PubChem CID 170797721) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 4-(2,4,6-trimethylphenyl)but-3-enamide.
| Compound Name | 4-(2,4,6-trimethylphenyl)but-3-enamide |
|---|---|
| PubChem CID | 170797721 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4-(2,4,6-trimethylphenyl)but-3-enamide |
| SMILES | Cc1cc(C)c(C=CCC(N)=O)c(C)c1 |
| InChI | InChI=1S/C13H17NO/c1-9-7-10(2)12(11(3)8-9)5-4-6-13(14)15/h4-5,7-8H,6H2,1-3H3,(H2,14,15) |
| InChIKey | OCXOWGKJDRRRBT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |