C13H17Cl — CID 170498967
2-(4-chlorobut-1-enyl)-1,3,5-trimethylbenzene (PubChem CID 170498967) has the molecular formula C13H17Cl and a molecular weight of 208.73 g/mol. Its IUPAC name is 2-(4-chlorobut-1-enyl)-1,3,5-trimethylbenzene.
| Compound Name | 2-(4-chlorobut-1-enyl)-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 170498967 |
| Molecular Formula | C13H17Cl |
| Molecular Weight | 208.73 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(4-chlorobut-1-enyl)-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(C=CCCCl)c(C)c1 |
| InChI | InChI=1S/C13H17Cl/c1-10-8-11(2)13(12(3)9-10)6-4-5-7-14/h4,6,8-9H,5,7H2,1-3H3 |
| InChIKey | YCJBMBWZTZNPIJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.73 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|