C12H14ClF — CID 170498963
2-(4-chlorobut-1-enyl)-5-fluoro-1,3-dimethylbenzene (PubChem CID 170498963) has the molecular formula C12H14ClF and a molecular weight of 212.69 g/mol. Its IUPAC name is 2-(4-chlorobut-1-enyl)-5-fluoro-1,3-dimethylbenzene.
| Compound Name | 2-(4-chlorobut-1-enyl)-5-fluoro-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 170498963 |
| Molecular Formula | C12H14ClF |
| Molecular Weight | 212.69 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-(4-chlorobut-1-enyl)-5-fluoro-1,3-dimethylbenzene |
| SMILES | Cc1cc(F)cc(C)c1C=CCCCl |
| InChI | InChI=1S/C12H14ClF/c1-9-7-11(14)8-10(2)12(9)5-3-4-6-13/h3,5,7-8H,4,6H2,1-2H3 |
| InChIKey | IUPGDYGDOZONSO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.69 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|