About 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene
1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene (PubChem CID 170499449) has the molecular formula C11H11ClF2O
and a molecular weight of 232.66 g/mol. Its IUPAC name is 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene.
Molecular Properties
| Compound Name | 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene |
| PubChem CID | 170499449 |
| Molecular Formula | C11H11ClF2O |
| Molecular Weight | 232.66 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene |
| SMILES | COc1c(F)cc(F)cc1C=CCCCl |
| InChI | InChI=1S/C11H11ClF2O/c1-15-11-8(4-2-3-5-12)6-9(13)7-10(11)14/h2,4,6-7H,3,5H2,1H3 |
| InChIKey | MJONEYKTHXUIFR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene?
The IUPAC name of 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene (CID 170499449) is 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene.
What is the SMILES notation for 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene?
The canonical SMILES for 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene is COc1c(F)cc(F)cc1C=CCCCl.
What is the InChIKey of 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene?
The InChIKey is MJONEYKTHXUIFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11ClF2O/c1-15-11-8(4-2-3-5-12)6-9(13)7-10(11)14/h2,4,6-7H,3,5H2,1H3.
What are the key properties of 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene?
1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene has a molecular weight of 232.66 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene is sourced from PubChem (CID 170499449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).