C11H11ClF2O — CID 170499449
1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene (PubChem CID 170499449) has the molecular formula C11H11ClF2O and a molecular weight of 232.66 g/mol. Its IUPAC name is 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene.
| Compound Name | 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene |
|---|---|
| PubChem CID | 170499449 |
| Molecular Formula | C11H11ClF2O |
| Molecular Weight | 232.66 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 1-(4-chlorobut-1-enyl)-3,5-difluoro-2-methoxybenzene |
| SMILES | COc1c(F)cc(F)cc1C=CCCCl |
| InChI | InChI=1S/C11H11ClF2O/c1-15-11-8(4-2-3-5-12)6-9(13)7-10(11)14/h2,4,6-7H,3,5H2,1H3 |
| InChIKey | MJONEYKTHXUIFR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|