C11H8ClF2N — CID 170499521
4-(4-chlorobut-1-enyl)-2,5-difluorobenzonitrile (PubChem CID 170499521) has the molecular formula C11H8ClF2N and a molecular weight of 227.64 g/mol. Its IUPAC name is 4-(4-chlorobut-1-enyl)-2,5-difluorobenzonitrile.
| Compound Name | 4-(4-chlorobut-1-enyl)-2,5-difluorobenzonitrile |
|---|---|
| PubChem CID | 170499521 |
| Molecular Formula | C11H8ClF2N |
| Molecular Weight | 227.64 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 4-(4-chlorobut-1-enyl)-2,5-difluorobenzonitrile |
| SMILES | N#Cc1cc(F)c(C=CCCCl)cc1F |
| InChI | InChI=1S/C11H8ClF2N/c12-4-2-1-3-8-5-11(14)9(7-15)6-10(8)13/h1,3,5-6H,2,4H2 |
| InChIKey | PBCQNDJOMYPJHB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.64 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|