C10H6F3N — CID 170799476
4-(2,4,5-trifluorophenyl)but-3-enenitrile (PubChem CID 170799476) has the molecular formula C10H6F3N and a molecular weight of 197.16 g/mol. Its IUPAC name is 4-(2,4,5-trifluorophenyl)but-3-enenitrile.
| Compound Name | 4-(2,4,5-trifluorophenyl)but-3-enenitrile |
|---|---|
| PubChem CID | 170799476 |
| Molecular Formula | C10H6F3N |
| Molecular Weight | 197.16 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 4-(2,4,5-trifluorophenyl)but-3-enenitrile |
| SMILES | N#CCC=Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C10H6F3N/c11-8-6-10(13)9(12)5-7(8)3-1-2-4-14/h1,3,5-6H,2H2 |
| InChIKey | OHFYBOFGDJZEGX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.16 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|