C11H14ClN — CID 169477372
4-(3-chloroprop-1-enyl)-3,5-dimethylaniline (PubChem CID 169477372) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is 4-(3-chloroprop-1-enyl)-3,5-dimethylaniline.
| Compound Name | 4-(3-chloroprop-1-enyl)-3,5-dimethylaniline |
|---|---|
| PubChem CID | 169477372 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 4-(3-chloroprop-1-enyl)-3,5-dimethylaniline |
| SMILES | Cc1cc(N)cc(C)c1C=CCCl |
| InChI | InChI=1S/C11H14ClN/c1-8-6-10(13)7-9(2)11(8)4-3-5-12/h3-4,6-7H,5,13H2,1-2H3 |
| InChIKey | FQMLTPWHMZYEOL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|