C9H6Cl2F2 — CID 169478438
5-chloro-2-(3-chloroprop-1-enyl)-1,3-difluorobenzene (PubChem CID 169478438) has the molecular formula C9H6Cl2F2 and a molecular weight of 223.05 g/mol. Its IUPAC name is 5-chloro-2-(3-chloroprop-1-enyl)-1,3-difluorobenzene.
| Compound Name | 5-chloro-2-(3-chloroprop-1-enyl)-1,3-difluorobenzene |
|---|---|
| PubChem CID | 169478438 |
| Molecular Formula | C9H6Cl2F2 |
| Molecular Weight | 223.05 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | 5-chloro-2-(3-chloroprop-1-enyl)-1,3-difluorobenzene |
| SMILES | Fc1cc(Cl)cc(F)c1C=CCCl |
| InChI | InChI=1S/C9H6Cl2F2/c10-3-1-2-7-8(12)4-6(11)5-9(7)13/h1-2,4-5H,3H2 |
| InChIKey | GFSWXZQGOFUPAA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.05 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|