C11H15NS — CID 169455191
3-(4-amino-2,6-dimethylphenyl)prop-2-ene-1-thiol (PubChem CID 169455191) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 3-(4-amino-2,6-dimethylphenyl)prop-2-ene-1-thiol.
| Compound Name | 3-(4-amino-2,6-dimethylphenyl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 169455191 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 3-(4-amino-2,6-dimethylphenyl)prop-2-ene-1-thiol |
| SMILES | Cc1cc(N)cc(C)c1C=CCS |
| InChI | InChI=1S/C11H15NS/c1-8-6-10(12)7-9(2)11(8)4-3-5-13/h3-4,6-7,13H,5,12H2,1-2H3 |
| InChIKey | KWGKBSIMKGFBNF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|