C11H14S — CID 169454689
3-(2,6-dimethylphenyl)prop-2-ene-1-thiol (PubChem CID 169454689) has the molecular formula C11H14S and a molecular weight of 178.30 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)prop-2-ene-1-thiol.
| Compound Name | 3-(2,6-dimethylphenyl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 169454689 |
| Molecular Formula | C11H14S |
| Molecular Weight | 178.30 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 3-(2,6-dimethylphenyl)prop-2-ene-1-thiol |
| SMILES | Cc1cccc(C)c1C=CCS |
| InChI | InChI=1S/C11H14S/c1-9-5-3-6-10(2)11(9)7-4-8-12/h3-7,12H,8H2,1-2H3 |
| InChIKey | XXFFLEIHTAWVDO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|