C22H24 — CID 102315083
2-[(1E,3E,5E)-6-(2,6-dimethylphenyl)hexa-1,3,5-trienyl]-1,3-dimethylbenzene (PubChem CID 102315083) has the molecular formula C22H24 and a molecular weight of 288.43 g/mol. Its IUPAC name is 2-[(1E,3E,5E)-6-(2,6-dimethylphenyl)hexa-1,3,5-trienyl]-1,3-dimethylbenzene.
| Compound Name | 2-[(1E,3E,5E)-6-(2,6-dimethylphenyl)hexa-1,3,5-trienyl]-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 102315083 |
| Molecular Formula | C22H24 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 2-[(1E,3E,5E)-6-(2,6-dimethylphenyl)hexa-1,3,5-trienyl]-1,3-dimethylbenzene |
| SMILES | Cc1cccc(C)c1/C=C/C=C/C=C/c1c(C)cccc1C |
| InChI | InChI=1S/C22H24/c1-17-11-9-12-18(2)21(17)15-7-5-6-8-16-22-19(3)13-10-14-20(22)4/h5-16H,1-4H3/b6-5+,15-7+,16-8+ |
| InChIKey | GMTIOJZYQVTMKK-SGOAZFLYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|