C18H30 — CID 142171523
2-[(1Z)-buta-1,3-dienyl]-1-methyl-3-propan-2-ylbenzene;ethane (PubChem CID 142171523) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-1-methyl-3-propan-2-ylbenzene;ethane.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-1-methyl-3-propan-2-ylbenzene;ethane |
|---|---|
| PubChem CID | 142171523 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-1-methyl-3-propan-2-ylbenzene;ethane |
| SMILES | C=C/C=C\c1c(C)cccc1C(C)C.CC.CC |
| InChI | InChI=1S/C14H18.2C2H6/c1-5-6-9-14-12(4)8-7-10-13(14)11(2)3;2*1-2/h5-11H,1H2,2-4H3;2*1-2H3/b9-6-;; |
| InChIKey | ABKGLZLJVLKBAU-MPTFJDTDSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|