About 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene
2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene (PubChem CID 142450771) has the molecular formula C16H22
and a molecular weight of 214.35 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene.
Molecular Properties
| Compound Name | 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene |
| PubChem CID | 142450771 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene |
| SMILES | C=Cc1c(C(C)C)ccc(C(C)C)c1C=C |
| InChI | InChI=1S/C16H22/c1-7-13-14(8-2)16(12(5)6)10-9-15(13)11(3)4/h7-12H,1-2H2,3-6H3 |
| InChIKey | UJBBABNOEARSTK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene?
The IUPAC name of 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene (CID 142450771) is 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene.
What is the SMILES notation for 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene?
The canonical SMILES for 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene is C=Cc1c(C(C)C)ccc(C(C)C)c1C=C.
What is the InChIKey of 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene?
The InChIKey is UJBBABNOEARSTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22/c1-7-13-14(8-2)16(12(5)6)10-9-15(13)11(3)4/h7-12H,1-2H2,3-6H3.
What are the key properties of 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene?
2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene has a molecular weight of 214.35 g/mol, XLogP of 5.22, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene is sourced from PubChem (CID 142450771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).