C16H22 — CID 142450771
2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene (PubChem CID 142450771) has the molecular formula C16H22 and a molecular weight of 214.35 g/mol. Its IUPAC name is 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene.
| Compound Name | 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 142450771 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2,3-bis(ethenyl)-1,4-di(propan-2-yl)benzene |
| SMILES | C=Cc1c(C(C)C)ccc(C(C)C)c1C=C |
| InChI | InChI=1S/C16H22/c1-7-13-14(8-2)16(12(5)6)10-9-15(13)11(3)4/h7-12H,1-2H2,3-6H3 |
| InChIKey | UJBBABNOEARSTK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |