About 2-methyl-6-propan-2-ylaniline;hydrofluoride
2-methyl-6-propan-2-ylaniline;hydrofluoride (PubChem CID 174802119) has the molecular formula C10H16FN
and a molecular weight of 169.24 g/mol. Its IUPAC name is 2-methyl-6-propan-2-ylaniline;hydrofluoride.
Molecular Properties
| Compound Name | 2-methyl-6-propan-2-ylaniline;hydrofluoride |
| PubChem CID | 174802119 |
| Molecular Formula | C10H16FN |
| Molecular Weight | 169.24 g/mol |
| Exact Mass | 169.13 |
| IUPAC Name | 2-methyl-6-propan-2-ylaniline;hydrofluoride |
| SMILES | Cc1cccc(C(C)C)c1N.F |
| InChI | InChI=1S/C10H15N.FH/c1-7(2)9-6-4-5-8(3)10(9)11;/h4-7H,11H2,1-3H3;1H |
| InChIKey | XQDBRLJDNTWBBC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-propan-2-ylaniline;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-propan-2-ylaniline;hydrofluoride?
The IUPAC name of 2-methyl-6-propan-2-ylaniline;hydrofluoride (CID 174802119) is 2-methyl-6-propan-2-ylaniline;hydrofluoride.
What is the SMILES notation for 2-methyl-6-propan-2-ylaniline;hydrofluoride?
The canonical SMILES for 2-methyl-6-propan-2-ylaniline;hydrofluoride is Cc1cccc(C(C)C)c1N.F.
What is the InChIKey of 2-methyl-6-propan-2-ylaniline;hydrofluoride?
The InChIKey is XQDBRLJDNTWBBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N.FH/c1-7(2)9-6-4-5-8(3)10(9)11;/h4-7H,11H2,1-3H3;1H.
What are the key properties of 2-methyl-6-propan-2-ylaniline;hydrofluoride?
2-methyl-6-propan-2-ylaniline;hydrofluoride has a molecular weight of 169.24 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-propan-2-ylaniline;hydrofluoride is sourced from PubChem (CID 174802119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).