C12H14O2S — CID 170478584
3-methyl-2-(4-sulfanylbut-1-enyl)benzoic acid (PubChem CID 170478584) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is 3-methyl-2-(4-sulfanylbut-1-enyl)benzoic acid.
| Compound Name | 3-methyl-2-(4-sulfanylbut-1-enyl)benzoic acid |
|---|---|
| PubChem CID | 170478584 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 3-methyl-2-(4-sulfanylbut-1-enyl)benzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1C=CCCS |
| InChI | InChI=1S/C12H14O2S/c1-9-5-4-7-11(12(13)14)10(9)6-2-3-8-15/h2,4-7,15H,3,8H2,1H3,(H,13,14) |
| InChIKey | DIDVGMMARUOMOP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|