About 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene
2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene (PubChem CID 11436211) has the molecular formula C16H24O
and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene |
| PubChem CID | 11436211 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene |
| SMILES | CCCCOC/C=C/c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H24O/c1-5-6-9-17-10-7-8-16-14(3)11-13(2)12-15(16)4/h7-8,11-12H,5-6,9-10H2,1-4H3/b8-7+ |
| InChIKey | JAOOCWIFBXMXMT-BQYQJAHWSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene?
The IUPAC name of 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene (CID 11436211) is 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene.
What is the SMILES notation for 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene?
The canonical SMILES for 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene is CCCCOC/C=C/c1c(C)cc(C)cc1C.
What is the InChIKey of 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene?
The InChIKey is JAOOCWIFBXMXMT-BQYQJAHWSA-N. The full InChI is InChI=1S/C16H24O/c1-5-6-9-17-10-7-8-16-14(3)11-13(2)12-15(16)4/h7-8,11-12H,5-6,9-10H2,1-4H3/b8-7+.
What are the key properties of 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene?
2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene has a molecular weight of 232.37 g/mol, XLogP of 4.44, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene is sourced from PubChem (CID 11436211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).