C16H24O — CID 11436211
2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene (PubChem CID 11436211) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 11436211 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 2-[(E)-3-butoxyprop-1-enyl]-1,3,5-trimethylbenzene |
| SMILES | CCCCOC/C=C/c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C16H24O/c1-5-6-9-17-10-7-8-16-14(3)11-13(2)12-15(16)4/h7-8,11-12H,5-6,9-10H2,1-4H3/b8-7+ |
| InChIKey | JAOOCWIFBXMXMT-BQYQJAHWSA-N |
| XLogP | 4.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|