C16H24O — CID 173058757
1,3-dimethyl-5-(3-pentoxyprop-1-enyl)benzene (PubChem CID 173058757) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3-pentoxyprop-1-enyl)benzene.
| Compound Name | 1,3-dimethyl-5-(3-pentoxyprop-1-enyl)benzene |
|---|---|
| PubChem CID | 173058757 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 1,3-dimethyl-5-(3-pentoxyprop-1-enyl)benzene |
| SMILES | CCCCCOCC=Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C16H24O/c1-4-5-6-9-17-10-7-8-16-12-14(2)11-15(3)13-16/h7-8,11-13H,4-6,9-10H2,1-3H3 |
| InChIKey | ISUGAVPHUAOKED-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|