C15H19Cl3O — CID 173058483
1,3,5-trichloro-2-[(E)-3-hexoxyprop-1-enyl]benzene (PubChem CID 173058483) has the molecular formula C15H19Cl3O and a molecular weight of 321.68 g/mol. Its IUPAC name is 1,3,5-trichloro-2-[(E)-3-hexoxyprop-1-enyl]benzene.
| Compound Name | 1,3,5-trichloro-2-[(E)-3-hexoxyprop-1-enyl]benzene |
|---|---|
| PubChem CID | 173058483 |
| Molecular Formula | C15H19Cl3O |
| Molecular Weight | 321.68 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 1,3,5-trichloro-2-[(E)-3-hexoxyprop-1-enyl]benzene |
| SMILES | CCCCCCOC/C=C/c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl3O/c1-2-3-4-5-8-19-9-6-7-13-14(17)10-12(16)11-15(13)18/h6-7,10-11H,2-5,8-9H2,1H3/b7-6+ |
| InChIKey | CTHLHZBFCQEXTN-VOTSOKGWSA-N |
| XLogP | 6.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.68 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|