C20H38O2 — CID 67628315
1-butoxybutane;propan-2-ol;1,3,5-trimethylbenzene (PubChem CID 67628315) has the molecular formula C20H38O2 and a molecular weight of 310.52 g/mol. Its IUPAC name is 1-butoxybutane;propan-2-ol;1,3,5-trimethylbenzene.
| Compound Name | 1-butoxybutane;propan-2-ol;1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 67628315 |
| Molecular Formula | C20H38O2 |
| Molecular Weight | 310.52 g/mol |
| Exact Mass | 310.29 |
| IUPAC Name | 1-butoxybutane;propan-2-ol;1,3,5-trimethylbenzene |
| SMILES | CC(C)O.CCCCOCCCC.Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C9H12.C8H18O.C3H8O/c1-7-4-8(2)6-9(3)5-7;1-3-5-7-9-8-6-4-2;1-3(2)4/h4-6H,1-3H3;3-8H2,1-2H3;3-4H,1-2H3 |
| InChIKey | MRMZMJUGUBCXQQ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|