C18H29NO3 — CID 171869191
2,3-dihydroxy-3-[2,4,6-tri(propan-2-yl)phenyl]propanamide (PubChem CID 171869191) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is 2,3-dihydroxy-3-[2,4,6-tri(propan-2-yl)phenyl]propanamide.
| Compound Name | 2,3-dihydroxy-3-[2,4,6-tri(propan-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 171869191 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 2,3-dihydroxy-3-[2,4,6-tri(propan-2-yl)phenyl]propanamide |
| SMILES | CC(C)c1cc(C(C)C)c(C(O)C(O)C(N)=O)c(C(C)C)c1 |
| InChI | InChI=1S/C18H29NO3/c1-9(2)12-7-13(10(3)4)15(14(8-12)11(5)6)16(20)17(21)18(19)22/h7-11,16-17,20-21H,1-6H3,(H2,19,22) |
| InChIKey | RLGQCBJZWIOYIU-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |