C28H35NO3 — CID 10274512
(E)-3-[3-[2-butoxy-3,5-di(propan-2-yl)phenyl]-1H-indol-5-yl]but-2-enoic acid (PubChem CID 10274512) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is (E)-3-[3-[2-butoxy-3,5-di(propan-2-yl)phenyl]-1H-indol-5-yl]but-2-enoic acid.
| Compound Name | (E)-3-[3-[2-butoxy-3,5-di(propan-2-yl)phenyl]-1H-indol-5-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 10274512 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | (E)-3-[3-[2-butoxy-3,5-di(propan-2-yl)phenyl]-1H-indol-5-yl]but-2-enoic acid |
| SMILES | CCCCOc1c(-c2c[nH]c3ccc(/C(C)=C/C(=O)O)cc23)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C28H35NO3/c1-7-8-11-32-28-22(18(4)5)14-21(17(2)3)15-24(28)25-16-29-26-10-9-20(13-23(25)26)19(6)12-27(30)31/h9-10,12-18,29H,7-8,11H2,1-6H3,(H,30,31)/b19-12+ |
| InChIKey | XOYJNOXXJQMGGK-XDHOZWIPSA-N |
| XLogP | 7.75 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|